C6H2Br2F2O — CID 84814133
2,6-dibromo-3,4-difluorophenol (PubChem CID 84814133) has the molecular formula C6H2Br2F2O and a molecular weight of 287.88 g/mol. Its IUPAC name is 2,6-dibromo-3,4-difluorophenol.
| Compound Name | 2,6-dibromo-3,4-difluorophenol |
|---|---|
| PubChem CID | 84814133 |
| Molecular Formula | C6H2Br2F2O |
| Molecular Weight | 287.88 g/mol |
| Exact Mass | 285.84 |
| IUPAC Name | 2,6-dibromo-3,4-difluorophenol |
| SMILES | Oc1c(Br)cc(F)c(F)c1Br |
| InChI | InChI=1S/C6H2Br2F2O/c7-2-1-3(9)5(10)4(8)6(2)11/h1,11H |
| InChIKey | CKKYYQDQIYNXOY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|