C6H3Br2FO2 — CID 142181565
4,5-dibromo-3-fluorobenzene-1,2-diol (PubChem CID 142181565) has the molecular formula C6H3Br2FO2 and a molecular weight of 285.89 g/mol. Its IUPAC name is 4,5-dibromo-3-fluorobenzene-1,2-diol.
| Compound Name | 4,5-dibromo-3-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 142181565 |
| Molecular Formula | C6H3Br2FO2 |
| Molecular Weight | 285.89 g/mol |
| Exact Mass | 283.85 |
| IUPAC Name | 4,5-dibromo-3-fluorobenzene-1,2-diol |
| SMILES | Oc1cc(Br)c(Br)c(F)c1O |
| InChI | InChI=1S/C6H3Br2FO2/c7-2-1-3(10)6(11)5(9)4(2)8/h1,10-11H |
| InChIKey | JMKIMRBWLAKMHX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.89 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|