C8H9BrFNO2 — CID 117378174
3-(2-aminoethyl)-5-bromo-4-fluorobenzene-1,2-diol (PubChem CID 117378174) has the molecular formula C8H9BrFNO2 and a molecular weight of 250.07 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5-bromo-4-fluorobenzene-1,2-diol.
| Compound Name | 3-(2-aminoethyl)-5-bromo-4-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 117378174 |
| Molecular Formula | C8H9BrFNO2 |
| Molecular Weight | 250.07 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 3-(2-aminoethyl)-5-bromo-4-fluorobenzene-1,2-diol |
| SMILES | NCCc1c(O)c(O)cc(Br)c1F |
| InChI | InChI=1S/C8H9BrFNO2/c9-5-3-6(12)8(13)4(1-2-11)7(5)10/h3,12-13H,1-2,11H2 |
| InChIKey | FIXSJWYWSWJAEH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.07 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|