C8H6BrF2NO3 — CID 66513152
(2S)-2-amino-2-(5-bromo-2,3-difluoro-6-hydroxyphenyl)acetic acid (PubChem CID 66513152) has the molecular formula C8H6BrF2NO3 and a molecular weight of 282.04 g/mol. Its IUPAC name is (2S)-2-amino-2-(5-bromo-2,3-difluoro-6-hydroxyphenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(5-bromo-2,3-difluoro-6-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 66513152 |
| Molecular Formula | C8H6BrF2NO3 |
| Molecular Weight | 282.04 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | (2S)-2-amino-2-(5-bromo-2,3-difluoro-6-hydroxyphenyl)acetic acid |
| SMILES | N[C@H](C(=O)O)c1c(O)c(Br)cc(F)c1F |
| InChI | InChI=1S/C8H6BrF2NO3/c9-2-1-3(10)5(11)4(7(2)13)6(12)8(14)15/h1,6,13H,12H2,(H,14,15)/t6-/m0/s1 |
| InChIKey | FTCUOKSVKDXJCY-LURJTMIESA-N |
| XLogP | 1.52 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.04 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|