C8H5BrF3NO2 — CID 117115132
2-amino-2-(3-bromo-2,5,6-trifluorophenyl)acetic acid (PubChem CID 117115132) has the molecular formula C8H5BrF3NO2 and a molecular weight of 284.03 g/mol. Its IUPAC name is 2-amino-2-(3-bromo-2,5,6-trifluorophenyl)acetic acid.
| Compound Name | 2-amino-2-(3-bromo-2,5,6-trifluorophenyl)acetic acid |
|---|---|
| PubChem CID | 117115132 |
| Molecular Formula | C8H5BrF3NO2 |
| Molecular Weight | 284.03 g/mol |
| Exact Mass | 282.95 |
| IUPAC Name | 2-amino-2-(3-bromo-2,5,6-trifluorophenyl)acetic acid |
| SMILES | NC(C(=O)O)c1c(F)c(F)cc(Br)c1F |
| InChI | InChI=1S/C8H5BrF3NO2/c9-2-1-3(10)6(12)4(5(2)11)7(13)8(14)15/h1,7H,13H2,(H,14,15) |
| InChIKey | SDWDRVZXSWMDHT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.03 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|