C9H5F4NO4 — CID 117421018
4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid (PubChem CID 117421018) has the molecular formula C9H5F4NO4 and a molecular weight of 267.13 g/mol. Its IUPAC name is 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid.
| Compound Name | 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 117421018 |
| Molecular Formula | C9H5F4NO4 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid |
| SMILES | NC(C(=O)O)c1c(F)c(F)c(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C9H5F4NO4/c10-3-1(7(14)9(17)18)4(11)6(13)2(5(3)12)8(15)16/h7H,14H2,(H,15,16)(H,17,18) |
| InChIKey | QRMHHADNKUFPJL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|