4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid

C9H5F4NO4 — CID 117421018

IUPAC4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid
SMILESNC(C(=O)O)c1c(F)c(F)c(C(=O)O)c(F)c1F
InChIInChI=1S/C9H5F4NO4/c10-3-1(7(14)9(17)18)4(11)6(13)2(5(3)12)8(15)16/h7H,14H2,(H,15,16)(H,17,18)
InChIKeyQRMHHADNKUFPJL-UHFFFAOYSA-N
MW267.13 g/mol
LogP1.03
Rot. Bonds3

About 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid

4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid (PubChem CID 117421018) has the molecular formula C9H5F4NO4 and a molecular weight of 267.13 g/mol. Its IUPAC name is 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid.

Molecular Properties

Compound Name4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid
PubChem CID117421018
Molecular FormulaC9H5F4NO4
Molecular Weight267.13 g/mol
Exact Mass267.02
IUPAC Name4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid
SMILESNC(C(=O)O)c1c(F)c(F)c(C(=O)O)c(F)c1F
InChIInChI=1S/C9H5F4NO4/c10-3-1(7(14)9(17)18)4(11)6(13)2(5(3)12)8(15)16/h7H,14H2,(H,15,16)(H,17,18)
InChIKeyQRMHHADNKUFPJL-UHFFFAOYSA-N
XLogP1.03
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.13
LogP ≤ 51.03
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid?
The IUPAC name of 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid (CID 117421018) is 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid.
What is the SMILES notation for 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid?
The canonical SMILES for 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid is NC(C(=O)O)c1c(F)c(F)c(C(=O)O)c(F)c1F.
What is the InChIKey of 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid?
The InChIKey is QRMHHADNKUFPJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F4NO4/c10-3-1(7(14)9(17)18)4(11)6(13)2(5(3)12)8(15)16/h7H,14H2,(H,15,16)(H,17,18).
What are the key properties of 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid?
4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid has a molecular weight of 267.13 g/mol, XLogP of 1.03, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[amino(carboxy)methyl]-2,3,5,6-tetrafluorobenzoic acid is sourced from PubChem (CID 117421018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).