C7H4F4N2O2 — CID 135313699
2-amino-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetic acid (PubChem CID 135313699) has the molecular formula C7H4F4N2O2 and a molecular weight of 224.11 g/mol. Its IUPAC name is 2-amino-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetic acid.
| Compound Name | 2-amino-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetic acid |
|---|---|
| PubChem CID | 135313699 |
| Molecular Formula | C7H4F4N2O2 |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-amino-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetic acid |
| SMILES | NC(C(=O)O)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C7H4F4N2O2/c8-2-1(4(12)7(14)15)3(9)6(11)13-5(2)10/h4H,12H2,(H,14,15) |
| InChIKey | OEOIBNJEPVCLJQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|