C8H6F4N2O2S — CID 22001835
2-amino-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]propanoic acid (PubChem CID 22001835) has the molecular formula C8H6F4N2O2S and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-amino-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 22001835 |
| Molecular Formula | C8H6F4N2O2S |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-amino-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]propanoic acid |
| SMILES | NC(CSc1c(F)c(F)nc(F)c1F)C(=O)O |
| InChI | InChI=1S/C8H6F4N2O2S/c9-3-5(17-1-2(13)8(15)16)4(10)7(12)14-6(3)11/h2H,1,13H2,(H,15,16) |
| InChIKey | SPNDYUXOEBHJCM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|