C6H8N2O3S — CID 106920713
2-amino-3-(1,3-oxazol-2-ylsulfanyl)propanoic acid (PubChem CID 106920713) has the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. Its IUPAC name is 2-amino-3-(1,3-oxazol-2-ylsulfanyl)propanoic acid.
| Compound Name | 2-amino-3-(1,3-oxazol-2-ylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 106920713 |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2-amino-3-(1,3-oxazol-2-ylsulfanyl)propanoic acid |
| SMILES | NC(CSc1ncco1)C(=O)O |
| InChI | InChI=1S/C6H8N2O3S/c7-4(5(9)10)3-12-6-8-1-2-11-6/h1-2,4H,3,7H2,(H,9,10) |
| InChIKey | AXNZLOBMJFMFFY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |