C6H9N3O2S — CID 106920732
2-amino-3-(1,3-oxazol-2-ylsulfanyl)propanamide (PubChem CID 106920732) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-amino-3-(1,3-oxazol-2-ylsulfanyl)propanamide.
| Compound Name | 2-amino-3-(1,3-oxazol-2-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 106920732 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-amino-3-(1,3-oxazol-2-ylsulfanyl)propanamide |
| SMILES | NC(=O)C(N)CSc1ncco1 |
| InChI | InChI=1S/C6H9N3O2S/c7-4(5(8)10)3-12-6-9-1-2-11-6/h1-2,4H,3,7H2,(H2,8,10) |
| InChIKey | TUCVVTKJYUAIHE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |