C11H11NO2S — CID 106923568
[4-(1,3-oxazol-2-ylsulfanylmethyl)phenyl]methanol (PubChem CID 106923568) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is [4-(1,3-oxazol-2-ylsulfanylmethyl)phenyl]methanol.
| Compound Name | [4-(1,3-oxazol-2-ylsulfanylmethyl)phenyl]methanol |
|---|---|
| PubChem CID | 106923568 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | [4-(1,3-oxazol-2-ylsulfanylmethyl)phenyl]methanol |
| SMILES | OCc1ccc(CSc2ncco2)cc1 |
| InChI | InChI=1S/C11H11NO2S/c13-7-9-1-3-10(4-2-9)8-15-11-12-5-6-14-11/h1-6,13H,7-8H2 |
| InChIKey | JEJIELYGOOXSGV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |