About 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid
2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid (PubChem CID 106920681) has the molecular formula C9H7NO4S
and a molecular weight of 225.22 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid.
Analyze 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid?
The IUPAC name of 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid (CID 106920681) is 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid.
What is the SMILES notation for 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid?
The canonical SMILES for 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid is O=C(O)c1ccoc1CSc1ncco1.
What is the InChIKey of 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid?
The InChIKey is XHTACKIGNZMIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4S/c11-8(12)6-1-3-13-7(6)5-15-9-10-2-4-14-9/h1-4H,5H2,(H,11,12).
What are the key properties of 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid?
2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid has a molecular weight of 225.22 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxazol-2-ylsulfanylmethyl)furan-3-carboxylic acid is sourced from PubChem (CID 106920681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).