C10H5BrFNO3S — CID 107540893
2-bromo-3-fluoro-4-(1,3-oxazol-2-ylsulfanyl)benzoic acid (PubChem CID 107540893) has the molecular formula C10H5BrFNO3S and a molecular weight of 318.12 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(1,3-oxazol-2-ylsulfanyl)benzoic acid.
| Compound Name | 2-bromo-3-fluoro-4-(1,3-oxazol-2-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 107540893 |
| Molecular Formula | C10H5BrFNO3S |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.92 |
| IUPAC Name | 2-bromo-3-fluoro-4-(1,3-oxazol-2-ylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1ccc(Sc2ncco2)c(F)c1Br |
| InChI | InChI=1S/C10H5BrFNO3S/c11-7-5(9(14)15)1-2-6(8(7)12)17-10-13-3-4-16-10/h1-4H,(H,14,15) |
| InChIKey | LZTIXZQJFKAYQD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |