C11H8FNO3S — CID 106926129
5-fluoro-2-(1,3-oxazol-2-ylsulfanylmethyl)benzoic acid (PubChem CID 106926129) has the molecular formula C11H8FNO3S and a molecular weight of 253.25 g/mol. Its IUPAC name is 5-fluoro-2-(1,3-oxazol-2-ylsulfanylmethyl)benzoic acid.
| Compound Name | 5-fluoro-2-(1,3-oxazol-2-ylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 106926129 |
| Molecular Formula | C11H8FNO3S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 5-fluoro-2-(1,3-oxazol-2-ylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1CSc1ncco1 |
| InChI | InChI=1S/C11H8FNO3S/c12-8-2-1-7(9(5-8)10(14)15)6-17-11-13-3-4-16-11/h1-5H,6H2,(H,14,15) |
| InChIKey | IPDYDHHYVNOPRB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |