C10H7BrFNOS — CID 106924329
2-[(3-bromo-5-fluorophenyl)methylsulfanyl]-1,3-oxazole (PubChem CID 106924329) has the molecular formula C10H7BrFNOS and a molecular weight of 288.14 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenyl)methylsulfanyl]-1,3-oxazole.
| Compound Name | 2-[(3-bromo-5-fluorophenyl)methylsulfanyl]-1,3-oxazole |
|---|---|
| PubChem CID | 106924329 |
| Molecular Formula | C10H7BrFNOS |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenyl)methylsulfanyl]-1,3-oxazole |
| SMILES | Fc1cc(Br)cc(CSc2ncco2)c1 |
| InChI | InChI=1S/C10H7BrFNOS/c11-8-3-7(4-9(12)5-8)6-15-10-13-1-2-14-10/h1-5H,6H2 |
| InChIKey | GVTUEHIEXWSNEX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |