About 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole
2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole (PubChem CID 130608822) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole.
Analyze 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole?
The IUPAC name of 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole (CID 130608822) is 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole.
What is the SMILES notation for 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole?
The canonical SMILES for 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole is Cn1nccc1CSc1ncco1.
What is the InChIKey of 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole?
The InChIKey is KPCBJXYKQCYHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-11-7(2-3-10-11)6-13-8-9-4-5-12-8/h2-5H,6H2,1H3.
What are the key properties of 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole?
2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole has a molecular weight of 195.25 g/mol, XLogP of 1.70, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methylpyrazol-3-yl)methylsulfanyl]-1,3-oxazole is sourced from PubChem (CID 130608822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).