About 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole
2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole (PubChem CID 106921258) has the molecular formula C7H5ClN2OS2
and a molecular weight of 232.72 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole |
| PubChem CID | 106921258 |
| Molecular Formula | C7H5ClN2OS2 |
| Molecular Weight | 232.72 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole |
| SMILES | Clc1ncc(CSc2ncco2)s1 |
| InChI | InChI=1S/C7H5ClN2OS2/c8-6-10-3-5(13-6)4-12-7-9-1-2-11-7/h1-3H,4H2 |
| InChIKey | AKCWSYMJCXDGBQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole (CID 106921258) is 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole is Clc1ncc(CSc2ncco2)s1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole?
The InChIKey is AKCWSYMJCXDGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2OS2/c8-6-10-3-5(13-6)4-12-7-9-1-2-11-7/h1-3H,4H2.
What are the key properties of 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole?
2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole has a molecular weight of 232.72 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-1,3-oxazole is sourced from PubChem (CID 106921258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).