C10H9ClN2OS — CID 106921858
4-chloro-2-(1,3-oxazol-2-ylsulfanylmethyl)aniline (PubChem CID 106921858) has the molecular formula C10H9ClN2OS and a molecular weight of 240.72 g/mol. Its IUPAC name is 4-chloro-2-(1,3-oxazol-2-ylsulfanylmethyl)aniline.
| Compound Name | 4-chloro-2-(1,3-oxazol-2-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 106921858 |
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 4-chloro-2-(1,3-oxazol-2-ylsulfanylmethyl)aniline |
| SMILES | Nc1ccc(Cl)cc1CSc1ncco1 |
| InChI | InChI=1S/C10H9ClN2OS/c11-8-1-2-9(12)7(5-8)6-15-10-13-3-4-14-10/h1-5H,6,12H2 |
| InChIKey | VIRYYSGJWSRSLZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|