C10H9N3O3S — CID 106925531
2-nitro-5-(1,3-oxazol-2-ylsulfanylmethyl)aniline (PubChem CID 106925531) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 2-nitro-5-(1,3-oxazol-2-ylsulfanylmethyl)aniline.
| Compound Name | 2-nitro-5-(1,3-oxazol-2-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 106925531 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-nitro-5-(1,3-oxazol-2-ylsulfanylmethyl)aniline |
| SMILES | Nc1cc(CSc2ncco2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N3O3S/c11-8-5-7(1-2-9(8)13(14)15)6-17-10-12-3-4-16-10/h1-5H,6,11H2 |
| InChIKey | GPXMATWJHLOYMY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|