C10H9FN2OS — CID 106921777
3-fluoro-5-(1,3-oxazol-2-ylsulfanylmethyl)aniline (PubChem CID 106921777) has the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-fluoro-5-(1,3-oxazol-2-ylsulfanylmethyl)aniline.
| Compound Name | 3-fluoro-5-(1,3-oxazol-2-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 106921777 |
| Molecular Formula | C10H9FN2OS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-fluoro-5-(1,3-oxazol-2-ylsulfanylmethyl)aniline |
| SMILES | Nc1cc(F)cc(CSc2ncco2)c1 |
| InChI | InChI=1S/C10H9FN2OS/c11-8-3-7(4-9(12)5-8)6-15-10-13-1-2-14-10/h1-5H,6,12H2 |
| InChIKey | PDHOWEVLLCPAEE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|