About 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid
3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid (PubChem CID 106926135) has the molecular formula C10H8N2O3S
and a molecular weight of 236.25 g/mol. Its IUPAC name is 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid.
Analyze 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid?
The IUPAC name of 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid (CID 106926135) is 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid?
The canonical SMILES for 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid is O=C(O)c1ncccc1CSc1ncco1.
What is the InChIKey of 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid?
The InChIKey is SJANHAOHIIFWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S/c13-9(14)8-7(2-1-3-11-8)6-16-10-12-4-5-15-10/h1-5H,6H2,(H,13,14).
What are the key properties of 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid?
3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid has a molecular weight of 236.25 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-oxazol-2-ylsulfanylmethyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 106926135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).