2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid

C9H5BrFN3O2S — CID 107540808

IUPAC2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid
SMILESO=C(O)c1ccc(Sc2ncn[nH]2)c(F)c1Br
InChIInChI=1S/C9H5BrFN3O2S/c10-6-4(8(15)16)1-2-5(7(6)11)17-9-12-3-13-14-9/h1-3H,(H,15,16)(H,12,13,14)
InChIKeyZALRTUBHKPRLID-UHFFFAOYSA-N
MW318.13 g/mol
LogP2.56
Rot. Bonds3

About 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid

2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid (PubChem CID 107540808) has the molecular formula C9H5BrFN3O2S and a molecular weight of 318.13 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid.

Molecular Properties

Compound Name2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid
PubChem CID107540808
Molecular FormulaC9H5BrFN3O2S
Molecular Weight318.13 g/mol
Exact Mass316.93
IUPAC Name2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid
SMILESO=C(O)c1ccc(Sc2ncn[nH]2)c(F)c1Br
InChIInChI=1S/C9H5BrFN3O2S/c10-6-4(8(15)16)1-2-5(7(6)11)17-9-12-3-13-14-9/h1-3H,(H,15,16)(H,12,13,14)
InChIKeyZALRTUBHKPRLID-UHFFFAOYSA-N
XLogP2.56
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.13
LogP ≤ 52.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid?
The IUPAC name of 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid (CID 107540808) is 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid.
What is the SMILES notation for 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid?
The canonical SMILES for 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid is O=C(O)c1ccc(Sc2ncn[nH]2)c(F)c1Br.
What is the InChIKey of 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid?
The InChIKey is ZALRTUBHKPRLID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrFN3O2S/c10-6-4(8(15)16)1-2-5(7(6)11)17-9-12-3-13-14-9/h1-3H,(H,15,16)(H,12,13,14).
What are the key properties of 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid?
2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid has a molecular weight of 318.13 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-fluoro-4-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid is sourced from PubChem (CID 107540808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).