C10H9N3O2S — CID 107112631
3-methyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid (PubChem CID 107112631) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-methyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid.
| Compound Name | 3-methyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 107112631 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 3-methyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1Sc1ncn[nH]1 |
| InChI | InChI=1S/C10H9N3O2S/c1-6-3-2-4-7(9(14)15)8(6)16-10-11-5-12-13-10/h2-5H,1H3,(H,14,15)(H,11,12,13) |
| InChIKey | OAUGMEHWTGMMQV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |