C14H10Cl2O2S — CID 112736361
2-(3,5-dichlorophenyl)sulfanyl-3-methylbenzoic acid (PubChem CID 112736361) has the molecular formula C14H10Cl2O2S and a molecular weight of 313.21 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)sulfanyl-3-methylbenzoic acid.
| Compound Name | 2-(3,5-dichlorophenyl)sulfanyl-3-methylbenzoic acid |
|---|---|
| PubChem CID | 112736361 |
| Molecular Formula | C14H10Cl2O2S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 2-(3,5-dichlorophenyl)sulfanyl-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2O2S/c1-8-3-2-4-12(14(17)18)13(8)19-11-6-9(15)5-10(16)7-11/h2-7H,1H3,(H,17,18) |
| InChIKey | BFGKITMPPKZBCD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |