C9H5ClN4O4S — CID 107191488
3-chloro-5-nitro-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid (PubChem CID 107191488) has the molecular formula C9H5ClN4O4S and a molecular weight of 300.68 g/mol. Its IUPAC name is 3-chloro-5-nitro-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid.
| Compound Name | 3-chloro-5-nitro-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 107191488 |
| Molecular Formula | C9H5ClN4O4S |
| Molecular Weight | 300.68 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 3-chloro-5-nitro-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc(Cl)c1Sc1ncn[nH]1 |
| InChI | InChI=1S/C9H5ClN4O4S/c10-6-2-4(14(17)18)1-5(8(15)16)7(6)19-9-11-3-12-13-9/h1-3H,(H,15,16)(H,11,12,13) |
| InChIKey | XUQYJIORPKQZOF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.68 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|