C10H6ClN3O4S2 — CID 107191646
3-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-nitrobenzoic acid (PubChem CID 107191646) has the molecular formula C10H6ClN3O4S2 and a molecular weight of 331.76 g/mol. Its IUPAC name is 3-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-nitrobenzoic acid.
| Compound Name | 3-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 107191646 |
| Molecular Formula | C10H6ClN3O4S2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 3-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-nitrobenzoic acid |
| SMILES | Cc1nsc(Sc2c(Cl)cc([N+](=O)[O-])cc2C(=O)O)n1 |
| InChI | InChI=1S/C10H6ClN3O4S2/c1-4-12-10(20-13-4)19-8-6(9(15)16)2-5(14(17)18)3-7(8)11/h2-3H,1H3,(H,15,16) |
| InChIKey | HIDAWKOFXGKYKO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|