C9H6N4O4S2 — CID 81439089
6-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid (PubChem CID 81439089) has the molecular formula C9H6N4O4S2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 6-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81439089 |
| Molecular Formula | C9H6N4O4S2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 6-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid |
| SMILES | Cc1nsc(Sc2ncc(C(=O)O)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H6N4O4S2/c1-4-11-9(19-12-4)18-7-6(13(16)17)2-5(3-10-7)8(14)15/h2-3H,1H3,(H,14,15) |
| InChIKey | PKSQTVWXEXEMCA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|