C12H6F2N2O4S — CID 81447801
6-(2,5-difluorophenyl)sulfanyl-5-nitropyridine-3-carboxylic acid (PubChem CID 81447801) has the molecular formula C12H6F2N2O4S and a molecular weight of 312.25 g/mol. Its IUPAC name is 6-(2,5-difluorophenyl)sulfanyl-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-(2,5-difluorophenyl)sulfanyl-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81447801 |
| Molecular Formula | C12H6F2N2O4S |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 6-(2,5-difluorophenyl)sulfanyl-5-nitropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(Sc2cc(F)ccc2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H6F2N2O4S/c13-7-1-2-8(14)10(4-7)21-11-9(16(19)20)3-6(5-15-11)12(17)18/h1-5H,(H,17,18) |
| InChIKey | ZTINEPNVQUPGSQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|