C10H7N3O4S2 — CID 113332130
3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-nitrobenzoic acid (PubChem CID 113332130) has the molecular formula C10H7N3O4S2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-nitrobenzoic acid.
| Compound Name | 3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 113332130 |
| Molecular Formula | C10H7N3O4S2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2-nitrobenzoic acid |
| SMILES | Cc1nsc(Sc2cccc(C(=O)O)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H7N3O4S2/c1-5-11-10(19-12-5)18-7-4-2-3-6(9(14)15)8(7)13(16)17/h2-4H,1H3,(H,14,15) |
| InChIKey | LHUOZRKLHSRUPM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|