C10H8N4O4S — CID 104602705
3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid (PubChem CID 104602705) has the molecular formula C10H8N4O4S and a molecular weight of 280.27 g/mol. Its IUPAC name is 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid.
| Compound Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 104602705 |
| Molecular Formula | C10H8N4O4S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitrobenzoic acid |
| SMILES | Cn1ncnc1Sc1cccc(C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N4O4S/c1-13-10(11-5-12-13)19-7-4-2-3-6(9(15)16)8(7)14(17)18/h2-5H,1H3,(H,15,16) |
| InChIKey | DLXDKNPLYOXVOX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|