C7H7N7O2S — CID 104604941
6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidin-4-amine (PubChem CID 104604941) has the molecular formula C7H7N7O2S and a molecular weight of 253.25 g/mol. Its IUPAC name is 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 104604941 |
| Molecular Formula | C7H7N7O2S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidin-4-amine |
| SMILES | Cn1ncnc1Sc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N7O2S/c1-13-7(11-3-12-13)17-6-4(14(15)16)5(8)9-2-10-6/h2-3H,1H3,(H2,8,9,10) |
| InChIKey | JWOWZBSZVBFNQE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|