C9H8N4O3S2 — CID 113431735
1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-4-nitrothiophen-2-yl]ethanone (PubChem CID 113431735) has the molecular formula C9H8N4O3S2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-4-nitrothiophen-2-yl]ethanone.
| Compound Name | 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-4-nitrothiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 113431735 |
| Molecular Formula | C9H8N4O3S2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 1-[5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-4-nitrothiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(Sc2ncnn2C)s1 |
| InChI | InChI=1S/C9H8N4O3S2/c1-5(14)7-3-6(13(15)16)8(17-7)18-9-10-4-11-12(9)2/h3-4H,1-2H3 |
| InChIKey | DAWMPDQYGVRSBV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|