C10H8N4O5S2 — CID 107786108
3-(5-acetyl-3-nitrothiophen-2-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786108) has the molecular formula C10H8N4O5S2 and a molecular weight of 328.33 g/mol. Its IUPAC name is 3-(5-acetyl-3-nitrothiophen-2-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-(5-acetyl-3-nitrothiophen-2-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786108 |
| Molecular Formula | C10H8N4O5S2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 3-(5-acetyl-3-nitrothiophen-2-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(Sc2nc(=O)c(=O)[nH]n2C)s1 |
| InChI | InChI=1S/C10H8N4O5S2/c1-4(15)6-3-5(14(18)19)9(20-6)21-10-11-7(16)8(17)12-13(10)2/h3H,1-2H3,(H,12,17) |
| InChIKey | YCHFFOUASVUBOR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 127.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|