C11H8ClN3O4S — CID 107782719
4-chloro-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzoic acid (PubChem CID 107782719) has the molecular formula C11H8ClN3O4S and a molecular weight of 313.72 g/mol. Its IUPAC name is 4-chloro-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzoic acid.
| Compound Name | 4-chloro-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 107782719 |
| Molecular Formula | C11H8ClN3O4S |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 4-chloro-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzoic acid |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C11H8ClN3O4S/c1-15-11(13-8(16)9(17)14-15)20-7-4-5(12)2-3-6(7)10(18)19/h2-4H,1H3,(H,14,17)(H,18,19) |
| InChIKey | UBHNCACNTDCICS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|