C11H10ClN5O3S — CID 107785977
4-chloro-N'-hydroxy-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzenecarboximidamide (PubChem CID 107785977) has the molecular formula C11H10ClN5O3S and a molecular weight of 327.75 g/mol. Its IUPAC name is 4-chloro-N'-hydroxy-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 4-chloro-N'-hydroxy-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107785977 |
| Molecular Formula | C11H10ClN5O3S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-chloro-N'-hydroxy-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzenecarboximidamide |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1cc(Cl)ccc1/C(N)=N/O |
| InChI | InChI=1S/C11H10ClN5O3S/c1-17-11(14-9(18)10(19)15-17)21-7-4-5(12)2-3-6(7)8(13)16-20/h2-4,20H,1H3,(H2,13,16)(H,15,19) |
| InChIKey | YYNBBRBFEJIRFR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|