C10H8N4O4S — CID 107782711
6-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-2-carboxylic acid (PubChem CID 107782711) has the molecular formula C10H8N4O4S and a molecular weight of 280.26 g/mol. Its IUPAC name is 6-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 107782711 |
| Molecular Formula | C10H8N4O4S |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 6-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-2-carboxylic acid |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C10H8N4O4S/c1-14-10(12-7(15)8(16)13-14)19-6-4-2-3-5(11-6)9(17)18/h2-4H,1H3,(H,13,16)(H,17,18) |
| InChIKey | ICZKYDXENQPZDL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|