C11H9N5O2S — CID 107785676
2-amino-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzonitrile (PubChem CID 107785676) has the molecular formula C11H9N5O2S and a molecular weight of 275.29 g/mol. Its IUPAC name is 2-amino-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzonitrile.
| Compound Name | 2-amino-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 107785676 |
| Molecular Formula | C11H9N5O2S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-amino-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzonitrile |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1cccc(C#N)c1N |
| InChI | InChI=1S/C11H9N5O2S/c1-16-11(14-9(17)10(18)15-16)19-7-4-2-3-6(5-12)8(7)13/h2-4H,13H2,1H3,(H,15,18) |
| InChIKey | ZNJNTJXLPKKSAU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|