C12H13N5O2S2 — CID 107786046
2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]-6-methylsulfanylbenzenecarboximidamide (PubChem CID 107786046) has the molecular formula C12H13N5O2S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]-6-methylsulfanylbenzenecarboximidamide.
| Compound Name | 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]-6-methylsulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107786046 |
| Molecular Formula | C12H13N5O2S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]-6-methylsulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(SC)cccc1Sc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C12H13N5O2S2/c1-17-12(15-10(18)11(19)16-17)21-7-5-3-4-6(20-2)8(7)9(13)14/h3-5H,1-2H3,(H3,13,14)(H,16,19) |
| InChIKey | GYBLCGAOILOJIG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|