C9H9N7O2S — CID 107786044
3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyrazine-2-carboximidamide (PubChem CID 107786044) has the molecular formula C9H9N7O2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyrazine-2-carboximidamide.
| Compound Name | 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 107786044 |
| Molecular Formula | C9H9N7O2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nccnc1Sc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C9H9N7O2S/c1-16-9(14-6(17)7(18)15-16)19-8-4(5(10)11)12-2-3-13-8/h2-3H,1H3,(H3,10,11)(H,15,18) |
| InChIKey | DJOYYFWPGBOCCR-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|