C12H13N5O2S — CID 107786069
3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]benzenecarboximidamide (PubChem CID 107786069) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]benzenecarboximidamide.
| Compound Name | 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107786069 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CSc2nc(=O)c(=O)[nH]n2C)c1 |
| InChI | InChI=1S/C12H13N5O2S/c1-17-12(15-10(18)11(19)16-17)20-6-7-3-2-4-8(5-7)9(13)14/h2-5H,6H2,1H3,(H3,13,14)(H,16,19) |
| InChIKey | UJRONUVCNWGTTD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|