C11H9BrFN3O2S — CID 107786454
3-[(2-bromo-3-fluorophenyl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786454) has the molecular formula C11H9BrFN3O2S and a molecular weight of 346.18 g/mol. Its IUPAC name is 3-[(2-bromo-3-fluorophenyl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(2-bromo-3-fluorophenyl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786454 |
| Molecular Formula | C11H9BrFN3O2S |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 3-[(2-bromo-3-fluorophenyl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCc1cccc(F)c1Br |
| InChI | InChI=1S/C11H9BrFN3O2S/c1-16-11(14-9(17)10(18)15-16)19-5-6-3-2-4-7(13)8(6)12/h2-4H,5H2,1H3,(H,15,18) |
| InChIKey | ZOASRSZZOKKJLW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|