C24H24N6S — CID 139854690
2-[[4-[2-(3-carbamimidoylphenyl)ethyl]phenyl]methylsulfanyl]-3H-benzimidazole-5-carboximidamide (PubChem CID 139854690) has the molecular formula C24H24N6S and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[[4-[2-(3-carbamimidoylphenyl)ethyl]phenyl]methylsulfanyl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[[4-[2-(3-carbamimidoylphenyl)ethyl]phenyl]methylsulfanyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 139854690 |
| Molecular Formula | C24H24N6S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[[4-[2-(3-carbamimidoylphenyl)ethyl]phenyl]methylsulfanyl]-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CCc2ccc(CSc3nc4ccc(/C(N)=N/[H])cc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C24H24N6S/c25-22(26)18-3-1-2-16(12-18)7-4-15-5-8-17(9-6-15)14-31-24-29-20-11-10-19(23(27)28)13-21(20)30-24/h1-3,5-6,8-13H,4,7,14H2,(H3,25,26)(H3,27,28)(H,29,30) |
| InChIKey | NBHDZSRPPJCKAN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|