C10H8N6O2S — CID 107785716
3-amino-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-4-carbonitrile (PubChem CID 107785716) has the molecular formula C10H8N6O2S and a molecular weight of 276.28 g/mol. Its IUPAC name is 3-amino-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107785716 |
| Molecular Formula | C10H8N6O2S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-amino-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-4-carbonitrile |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1nccc(C#N)c1N |
| InChI | InChI=1S/C10H8N6O2S/c1-16-10(14-7(17)8(18)15-16)19-9-6(12)5(4-11)2-3-13-9/h2-3H,12H2,1H3,(H,15,18) |
| InChIKey | XDYDYBMPMZJXCL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 130.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|