C10H7N5O2S — CID 107785888
6-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-2-carbonitrile (PubChem CID 107785888) has the molecular formula C10H7N5O2S and a molecular weight of 261.27 g/mol. Its IUPAC name is 6-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-2-carbonitrile.
| Compound Name | 6-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 107785888 |
| Molecular Formula | C10H7N5O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 6-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pyridine-2-carbonitrile |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1cccc(C#N)n1 |
| InChI | InChI=1S/C10H7N5O2S/c1-15-10(13-8(16)9(17)14-15)18-7-4-2-3-6(5-11)12-7/h2-4H,1H3,(H,14,17) |
| InChIKey | VMDXMBVQEQDERV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|