4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid

C12H11ClN2O2S — CID 55181565

IUPAC4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid
SMILESCc1cc(Sc2cc(Cl)ccc2C(=O)O)n(C)n1
InChIInChI=1S/C12H11ClN2O2S/c1-7-5-11(15(2)14-7)18-10-6-8(13)3-4-9(10)12(16)17/h3-6H,1-2H3,(H,16,17)
InChIKeyMDEOJFHPTNKLBU-UHFFFAOYSA-N
MW282.75 g/mol
LogP3.23
Rot. Bonds3

About 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid

4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid (PubChem CID 55181565) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid.

Molecular Properties

Compound Name4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid
PubChem CID55181565
Molecular FormulaC12H11ClN2O2S
Molecular Weight282.75 g/mol
Exact Mass282.02
IUPAC Name4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid
SMILESCc1cc(Sc2cc(Cl)ccc2C(=O)O)n(C)n1
InChIInChI=1S/C12H11ClN2O2S/c1-7-5-11(15(2)14-7)18-10-6-8(13)3-4-9(10)12(16)17/h3-6H,1-2H3,(H,16,17)
InChIKeyMDEOJFHPTNKLBU-UHFFFAOYSA-N
XLogP3.23
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.75
LogP ≤ 53.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid?
The IUPAC name of 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid (CID 55181565) is 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid.
What is the SMILES notation for 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid?
The canonical SMILES for 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid is Cc1cc(Sc2cc(Cl)ccc2C(=O)O)n(C)n1.
What is the InChIKey of 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid?
The InChIKey is MDEOJFHPTNKLBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O2S/c1-7-5-11(15(2)14-7)18-10-6-8(13)3-4-9(10)12(16)17/h3-6H,1-2H3,(H,16,17).
What are the key properties of 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid?
4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid has a molecular weight of 282.75 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,5-dimethylpyrazol-3-yl)sulfanylbenzoic acid is sourced from PubChem (CID 55181565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).