C12H11N3O4S — CID 62409161
2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-nitrobenzoic acid (PubChem CID 62409161) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-nitrobenzoic acid.
| Compound Name | 2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 62409161 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-(2,5-dimethylpyrazol-3-yl)sulfanyl-5-nitrobenzoic acid |
| SMILES | Cc1cc(Sc2ccc([N+](=O)[O-])cc2C(=O)O)n(C)n1 |
| InChI | InChI=1S/C12H11N3O4S/c1-7-5-11(14(2)13-7)20-10-4-3-8(15(18)19)6-9(10)12(16)17/h3-6H,1-2H3,(H,16,17) |
| InChIKey | QLKJKQYNEHSYJL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|