C12H9N3O5S — CID 135895414
2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrobenzoic acid (PubChem CID 135895414) has the molecular formula C12H9N3O5S and a molecular weight of 307.29 g/mol. Its IUPAC name is 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrobenzoic acid.
| Compound Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 135895414 |
| Molecular Formula | C12H9N3O5S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrobenzoic acid |
| SMILES | Cc1cc(=O)[nH]c(Sc2ccc([N+](=O)[O-])cc2C(=O)O)n1 |
| InChI | InChI=1S/C12H9N3O5S/c1-6-4-10(16)14-12(13-6)21-9-3-2-7(15(19)20)5-8(9)11(17)18/h2-5H,1H3,(H,17,18)(H,13,14,16) |
| InChIKey | UXFGHTNGYAIZPB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|