C11H8N4O5S — CID 136726964
2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid (PubChem CID 136726964) has the molecular formula C11H8N4O5S and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid.
| Compound Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 136726964 |
| Molecular Formula | C11H8N4O5S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid |
| SMILES | Cc1cc(=O)[nH]c(Sc2ncc([N+](=O)[O-])cc2C(=O)O)n1 |
| InChI | InChI=1S/C11H8N4O5S/c1-5-2-8(16)14-11(13-5)21-9-7(10(17)18)3-6(4-12-9)15(19)20/h2-4H,1H3,(H,17,18)(H,13,14,16) |
| InChIKey | INYJTNQKQWLDNI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|