C11H8FN3O3S — CID 136886230
3-fluoro-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-4-carboxylic acid (PubChem CID 136886230) has the molecular formula C11H8FN3O3S and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-fluoro-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-4-carboxylic acid.
| Compound Name | 3-fluoro-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 136886230 |
| Molecular Formula | C11H8FN3O3S |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 3-fluoro-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyridine-4-carboxylic acid |
| SMILES | Cc1cc(=O)[nH]c(Sc2nccc(C(=O)O)c2F)n1 |
| InChI | InChI=1S/C11H8FN3O3S/c1-5-4-7(16)15-11(14-5)19-9-8(12)6(10(17)18)2-3-13-9/h2-4H,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | QNMIWJULDVDCOQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |