C13H12N2O3S2 — CID 136695147
2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-6-methylsulfanylbenzoic acid (PubChem CID 136695147) has the molecular formula C13H12N2O3S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-6-methylsulfanylbenzoic acid.
| Compound Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-6-methylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 136695147 |
| Molecular Formula | C13H12N2O3S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-6-methylsulfanylbenzoic acid |
| SMILES | CSc1cccc(Sc2nc(C)cc(=O)[nH]2)c1C(=O)O |
| InChI | InChI=1S/C13H12N2O3S2/c1-7-6-10(16)15-13(14-7)20-9-5-3-4-8(19-2)11(9)12(17)18/h3-6H,1-2H3,(H,17,18)(H,14,15,16) |
| InChIKey | SXFDHWGOSRMMSL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |